C22H22ClNO2 — CID 39427467
(3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid (PubChem CID 39427467) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid.
| Compound Name | (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 39427467 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
| SMILES | CC(C)c1ccc([C@@H]2Nc3c(Cl)ccc(C(=O)O)c3[C@@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C22H22ClNO2/c1-12(2)13-6-8-14(9-7-13)20-16-5-3-4-15(16)19-17(22(25)26)10-11-18(23)21(19)24-20/h3-4,6-12,15-16,20,24H,5H2,1-2H3,(H,25,26)/t15-,16-,20+/m1/s1 |
| InChIKey | ULGTZQFPISRTQD-QINHECLXSA-N |
| XLogP | 5.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|