C23H24ClNO2 — CID 126176971
methyl (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate (PubChem CID 126176971) has the molecular formula C23H24ClNO2 and a molecular weight of 381.90 g/mol. Its IUPAC name is methyl (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate.
| Compound Name | methyl (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 126176971 |
| Molecular Formula | C23H24ClNO2 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | methyl (3aR,4R,9bR)-6-chloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c2c1[C@@H]1C=CC[C@H]1[C@H](c1ccc(C(C)C)cc1)N2 |
| InChI | InChI=1S/C23H24ClNO2/c1-13(2)14-7-9-15(10-8-14)21-17-6-4-5-16(17)20-18(23(26)27-3)11-12-19(24)22(20)25-21/h4-5,7-13,16-17,21,25H,6H2,1-3H3/t16-,17-,21+/m1/s1 |
| InChIKey | WRNWKFRGVIBHHX-LZJOCLMNSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|