C19H17ClN2O2 — CID 5297395
methyl (4S)-6-chloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate (PubChem CID 5297395) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is methyl (4S)-6-chloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate.
| Compound Name | methyl (4S)-6-chloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 5297395 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | methyl (4S)-6-chloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c2c1C1C=CCC1[C@@H](c1cccnc1)N2 |
| InChI | InChI=1S/C19H17ClN2O2/c1-24-19(23)14-7-8-15(20)18-16(14)12-5-2-6-13(12)17(22-18)11-4-3-9-21-10-11/h2-5,7-10,12-13,17,22H,6H2,1H3/t12?,13?,17-/m1/s1 |
| InChIKey | QOJLCDHPSFFGKY-QWQCLYJRSA-N |
| XLogP | 4.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|