C17H14Cl2N2 — CID 6977882
(3aS,4R,9bS)-6,9-dichloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 6977882) has the molecular formula C17H14Cl2N2 and a molecular weight of 317.22 g/mol. Its IUPAC name is (3aS,4R,9bS)-6,9-dichloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-6,9-dichloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 6977882 |
| Molecular Formula | C17H14Cl2N2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (3aS,4R,9bS)-6,9-dichloro-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1ccc(Cl)c2c1N[C@@H](c1cccnc1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C17H14Cl2N2/c18-13-6-7-14(19)17-15(13)11-4-1-5-12(11)16(21-17)10-3-2-8-20-9-10/h1-4,6-9,11-12,16,21H,5H2/t11-,12-,16-/m0/s1 |
| InChIKey | MZSQUMXQODANFL-MKBNYLNASA-N |
| XLogP | 5.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|