C24H20ClNO2 — CID 99117268
methyl (3aS,4S,9bR)-6-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate (PubChem CID 99117268) has the molecular formula C24H20ClNO2 and a molecular weight of 389.88 g/mol. Its IUPAC name is methyl (3aS,4S,9bR)-6-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate.
| Compound Name | methyl (3aS,4S,9bR)-6-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 99117268 |
| Molecular Formula | C24H20ClNO2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl (3aS,4S,9bR)-6-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c2c1[C@@H]1C=CC[C@@H]1[C@@H](c1cccc3ccccc13)N2 |
| InChI | InChI=1S/C24H20ClNO2/c1-28-24(27)19-12-13-20(25)23-21(19)16-9-5-11-18(16)22(26-23)17-10-4-7-14-6-2-3-8-15(14)17/h2-10,12-13,16,18,22,26H,11H2,1H3/t16-,18+,22-/m1/s1 |
| InChIKey | HWGSLBXHTZZQOT-TVTNDZMWSA-N |
| XLogP | 6.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|