C21H20FNO2 — CID 21229985
methyl (4S)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate (PubChem CID 21229985) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is methyl (4S)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate.
| Compound Name | methyl (4S)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 21229985 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | methyl (4S)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylate |
| SMILES | COC(=O)c1ccc(C)c2c1C1C=CCC1[C@@H](c1ccccc1F)N2 |
| InChI | InChI=1S/C21H20FNO2/c1-12-10-11-16(21(24)25-2)18-13-7-5-8-14(13)20(23-19(12)18)15-6-3-4-9-17(15)22/h3-7,9-11,13-14,20,23H,8H2,1-2H3/t13?,14?,20-/m0/s1 |
| InChIKey | WGBCTMBCHGBEBX-DHRDCHLVSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|