C20H17FNO2- — CID 11878456
(3aR,4R,9bS)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate (PubChem CID 11878456) has the molecular formula C20H17FNO2- and a molecular weight of 322.36 g/mol. Its IUPAC name is (3aR,4R,9bS)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate.
| Compound Name | (3aR,4R,9bS)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 11878456 |
| Molecular Formula | C20H17FNO2- |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3aR,4R,9bS)-4-(2-fluorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate |
| SMILES | Cc1c(C(=O)[O-])ccc2c1N[C@@H](c1ccccc1F)[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C20H18FNO2/c1-11-12(20(23)24)9-10-15-13-6-4-7-14(13)19(22-18(11)15)16-5-2-3-8-17(16)21/h2-6,8-10,13-14,19,22H,7H2,1H3,(H,23,24)/p-1/t13-,14+,19+/m0/s1 |
| InChIKey | KGUUTDNUDFPRBO-IQUTYRLHSA-M |
| XLogP | 3.32 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|