C26H22ClNO3 — CID 21229962
(4S)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid (PubChem CID 21229962) has the molecular formula C26H22ClNO3 and a molecular weight of 431.92 g/mol. Its IUPAC name is (4S)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid.
| Compound Name | (4S)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 21229962 |
| Molecular Formula | C26H22ClNO3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (4S)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)c2c1C1C=CCC1[C@@H](c1ccc(OCc3ccccc3)cc1)N2 |
| InChI | InChI=1S/C26H22ClNO3/c27-22-14-13-21(26(29)30)23-19-7-4-8-20(19)24(28-25(22)23)17-9-11-18(12-10-17)31-15-16-5-2-1-3-6-16/h1-7,9-14,19-20,24,28H,8,15H2,(H,29,30)/t19?,20?,24-/m1/s1 |
| InChIKey | UJBODOYKWBPKKC-ZSHKSDETSA-N |
| XLogP | 6.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|