C25H21Cl2NO — CID 17239978
7,9-dichloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17239978) has the molecular formula C25H21Cl2NO and a molecular weight of 422.36 g/mol. Its IUPAC name is 7,9-dichloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 7,9-dichloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17239978 |
| Molecular Formula | C25H21Cl2NO |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 7,9-dichloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1cc(Cl)c2c(c1)NC(c1ccc(OCc3ccccc3)cc1)C1CC=CC21 |
| InChI | InChI=1S/C25H21Cl2NO/c26-18-13-22(27)24-20-7-4-8-21(20)25(28-23(24)14-18)17-9-11-19(12-10-17)29-15-16-5-2-1-3-6-16/h1-7,9-14,20-21,25,28H,8,15H2 |
| InChIKey | NBJIZZSOUCMFEN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|