C18H15Cl2NO2 — CID 17236728
4-(7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzene-1,3-diol (PubChem CID 17236728) has the molecular formula C18H15Cl2NO2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-(7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzene-1,3-diol.
| Compound Name | 4-(7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 17236728 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-(7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2Nc3cc(Cl)cc(Cl)c3C3C=CCC32)c(O)c1 |
| InChI | InChI=1S/C18H15Cl2NO2/c19-9-6-14(20)17-11-2-1-3-12(11)18(21-15(17)7-9)13-5-4-10(22)8-16(13)23/h1-2,4-8,11-12,18,21-23H,3H2 |
| InChIKey | GKZZYHWDWHXJDQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|