C13H10Cl2NO2- — CID 11870407
(3aS,4R,9bS)-7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 11870407) has the molecular formula C13H10Cl2NO2- and a molecular weight of 283.13 g/mol. Its IUPAC name is (3aS,4R,9bS)-7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | (3aS,4R,9bS)-7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 11870407 |
| Molecular Formula | C13H10Cl2NO2- |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | (3aS,4R,9bS)-7,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | O=C([O-])[C@@H]1Nc2cc(Cl)cc(Cl)c2[C@H]2C=CC[C@@H]21 |
| InChI | InChI=1S/C13H11Cl2NO2/c14-6-4-9(15)11-7-2-1-3-8(7)12(13(17)18)16-10(11)5-6/h1-2,4-5,7-8,12,16H,3H2,(H,17,18)/p-1/t7-,8-,12+/m0/s1 |
| InChIKey | CBCFDRNSQSSDPC-YVZVNANGSA-M |
| XLogP | 2.20 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|