C17H14NO2- — CID 7331540
(12R,13R,17S)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene-12-carboxylate (PubChem CID 7331540) has the molecular formula C17H14NO2- and a molecular weight of 264.30 g/mol. Its IUPAC name is (12R,13R,17S)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene-12-carboxylate.
| Compound Name | (12R,13R,17S)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 7331540 |
| Molecular Formula | C17H14NO2- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (12R,13R,17S)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene-12-carboxylate |
| SMILES | O=C([O-])[C@@H]1Nc2ccc3ccccc3c2[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C17H15NO2/c19-17(20)16-13-7-3-6-12(13)15-11-5-2-1-4-10(11)8-9-14(15)18-16/h1-6,8-9,12-13,16,18H,7H2,(H,19,20)/p-1/t12-,13+,16+/m0/s1 |
| InChIKey | GLXGRTQDOFCAAZ-WOSRLPQWSA-M |
| XLogP | 2.04 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|