C29H23N3O3 — CID 40618056
N-[3-[(12R,13R,17R)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaen-12-yl]phenyl]-4-nitrobenzamide (PubChem CID 40618056) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[3-[(12R,13R,17R)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaen-12-yl]phenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[(12R,13R,17R)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaen-12-yl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 40618056 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[3-[(12R,13R,17R)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaen-12-yl]phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cccc([C@@H]2Nc3ccc4ccccc4c3[C@@H]3C=CC[C@H]32)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H23N3O3/c33-29(19-11-14-22(15-12-19)32(34)35)30-21-7-3-6-20(17-21)28-25-10-4-9-24(25)27-23-8-2-1-5-18(23)13-16-26(27)31-28/h1-9,11-17,24-25,28,31H,10H2,(H,30,33)/t24-,25-,28+/m1/s1 |
| InChIKey | JFGOGUHCUWAEIJ-SKVJQKLOSA-N |
| XLogP | 6.83 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|