C34H34N2O2 — CID 17242472
4-tert-butyl-N-[4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide (PubChem CID 17242472) has the molecular formula C34H34N2O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 17242472 |
| Molecular Formula | C34H34N2O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-tert-butyl-N-[4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide |
| SMILES | COc1ccc2ccccc2c1C1Nc2ccc(NC(=O)c3ccc(C(C)(C)C)cc3)cc2C2C=CCC21 |
| InChI | InChI=1S/C34H34N2O2/c1-34(2,3)23-15-12-22(13-16-23)33(37)35-24-17-18-29-28(20-24)26-10-7-11-27(26)32(36-29)31-25-9-6-5-8-21(25)14-19-30(31)38-4/h5-10,12-20,26-27,32,36H,11H2,1-4H3,(H,35,37) |
| InChIKey | IFTBRIPGTMCIQA-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|