C29H32N2O3S — CID 17242309
N-cyclohexyl-4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17242309) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-cyclohexyl-4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-cyclohexyl-4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17242309 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-cyclohexyl-4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | COc1ccc2ccccc2c1C1Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2C2C=CCC21 |
| InChI | InChI=1S/C29H32N2O3S/c1-34-27-17-14-19-8-5-6-11-22(19)28(27)29-24-13-7-12-23(24)25-18-21(15-16-26(25)30-29)35(32,33)31-20-9-3-2-4-10-20/h5-8,11-12,14-18,20,23-24,29-31H,2-4,9-10,13H2,1H3 |
| InChIKey | SQDUZIWNYYJUET-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|