C25H23NO3 — CID 17242357
methyl 4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 17242357) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl 4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | methyl 4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 17242357 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl 4-(2-methoxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1C=CCC1C(c1c(OC)ccc3ccccc13)N2 |
| InChI | InChI=1S/C25H23NO3/c1-28-22-13-11-15-6-3-4-7-17(15)23(22)24-19-9-5-8-18(19)20-14-16(25(27)29-2)10-12-21(20)26-24/h3-8,10-14,18-19,24,26H,9H2,1-2H3 |
| InChIKey | WPJLAOMMTOWUAU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|