C30H32N2O — CID 17242144
4-tert-butyl-N-[4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide (PubChem CID 17242144) has the molecular formula C30H32N2O and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 17242144 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-tert-butyl-N-[4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide |
| SMILES | Cc1cccc(C2Nc3ccc(NC(=O)c4ccc(C(C)(C)C)cc4)cc3C3C=CCC32)c1 |
| InChI | InChI=1S/C30H32N2O/c1-19-7-5-8-21(17-19)28-25-10-6-9-24(25)26-18-23(15-16-27(26)32-28)31-29(33)20-11-13-22(14-12-20)30(2,3)4/h5-9,11-18,24-25,28,32H,10H2,1-4H3,(H,31,33) |
| InChIKey | LLZVVFHPLODAOA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|