C22H23ClN2O — CID 17238661
N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide (PubChem CID 17238661) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide.
| Compound Name | N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide |
|---|---|
| PubChem CID | 17238661 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H23ClN2O/c1-2-5-21(26)24-16-10-11-20-19(13-16)17-8-4-9-18(17)22(25-20)14-6-3-7-15(23)12-14/h3-4,6-8,10-13,17-18,22,25H,2,5,9H2,1H3,(H,24,26) |
| InChIKey | XJVKQKMZADELSL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|