C21H24N2OS — CID 17237678
N-[4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide (PubChem CID 17237678) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide.
| Compound Name | N-[4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide |
|---|---|
| PubChem CID | 17237678 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C1C=CCC1C(c1ccc(C)s1)N2 |
| InChI | InChI=1S/C21H24N2OS/c1-3-5-20(24)22-14-9-10-18-17(12-14)15-6-4-7-16(15)21(23-18)19-11-8-13(2)25-19/h4,6,8-12,15-16,21,23H,3,5,7H2,1-2H3,(H,22,24) |
| InChIKey | LSAXVQMKICWTBY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|