C25H30N2O4 — CID 17237002
N-[4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide (PubChem CID 17237002) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide.
| Compound Name | N-[4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide |
|---|---|
| PubChem CID | 17237002 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C1C=CCC1C(c1cc(OC)c(OC)c(OC)c1)N2 |
| InChI | InChI=1S/C25H30N2O4/c1-5-7-23(28)26-16-10-11-20-19(14-16)17-8-6-9-18(17)24(27-20)15-12-21(29-2)25(31-4)22(13-15)30-3/h6,8,10-14,17-18,24,27H,5,7,9H2,1-4H3,(H,26,28) |
| InChIKey | YRKUFZZWXPURSB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|