C25H28N2O4 — CID 17239925
[2-methoxy-4-[8-(2-methylpropanoylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] acetate (PubChem CID 17239925) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is [2-methoxy-4-[8-(2-methylpropanoylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[8-(2-methylpropanoylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 17239925 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [2-methoxy-4-[8-(2-methylpropanoylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] acetate |
| SMILES | COc1cc(C2Nc3ccc(NC(=O)C(C)C)cc3C3C=CCC32)ccc1OC(C)=O |
| InChI | InChI=1S/C25H28N2O4/c1-14(2)25(29)26-17-9-10-21-20(13-17)18-6-5-7-19(18)24(27-21)16-8-11-22(31-15(3)28)23(12-16)30-4/h5-6,8-14,18-19,24,27H,7H2,1-4H3,(H,26,29) |
| InChIKey | AMHWEWIKCOINIY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|