C29H30N2O2 — CID 17241213
2-methyl-N-[4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide (PubChem CID 17241213) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-methyl-N-[4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide.
| Compound Name | 2-methyl-N-[4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide |
|---|---|
| PubChem CID | 17241213 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-methyl-N-[4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)C1C=CCC1C(c1ccccc1OCc1ccccc1)N2 |
| InChI | InChI=1S/C29H30N2O2/c1-19(2)29(32)30-21-15-16-26-25(17-21)22-12-8-13-23(22)28(31-26)24-11-6-7-14-27(24)33-18-20-9-4-3-5-10-20/h3-12,14-17,19,22-23,28,31H,13,18H2,1-2H3,(H,30,32) |
| InChIKey | NEFSKPBOIHFXQB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|