C33H32N2O3S — CID 17241078
N-(3,4-dimethylphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17241078) has the molecular formula C33H32N2O3S and a molecular weight of 536.70 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17241078 |
| Molecular Formula | C33H32N2O3S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)C2C=CCC2C(c2ccccc2OCc2ccccc2)N3)cc1C |
| InChI | InChI=1S/C33H32N2O3S/c1-22-15-16-25(19-23(22)2)35-39(36,37)26-17-18-31-30(20-26)27-12-8-13-28(27)33(34-31)29-11-6-7-14-32(29)38-21-24-9-4-3-5-10-24/h3-12,14-20,27-28,33-35H,13,21H2,1-2H3 |
| InChIKey | QYGCQIGERGZGJP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|