C26H25FN2O4S — CID 2979303
4-(2,3-dimethoxyphenyl)-N-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 2979303) has the molecular formula C26H25FN2O4S and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-N-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(2,3-dimethoxyphenyl)-N-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 2979303 |
| Molecular Formula | C26H25FN2O4S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-N-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | COc1cccc(C2Nc3ccc(S(=O)(=O)Nc4ccc(F)cc4)cc3C3C=CCC32)c1OC |
| InChI | InChI=1S/C26H25FN2O4S/c1-32-24-8-4-7-21(26(24)33-2)25-20-6-3-5-19(20)22-15-18(13-14-23(22)28-25)34(30,31)29-17-11-9-16(27)10-12-17/h3-5,7-15,19-20,25,28-29H,6H2,1-2H3 |
| InChIKey | AAUVXYKHBGERAS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|