C28H30N2O4S — CID 22193564
(3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 22193564) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 22193564 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-N-(2,6-dimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | COc1cccc([C@@H]2Nc3ccc(S(=O)(=O)Nc4c(C)cccc4C)cc3[C@@H]3C=CC[C@@H]32)c1OC |
| InChI | InChI=1S/C28H30N2O4S/c1-17-8-5-9-18(2)26(17)30-35(31,32)19-14-15-24-23(16-19)20-10-6-11-21(20)27(29-24)22-12-7-13-25(33-3)28(22)34-4/h5-10,12-16,20-21,27,29-30H,11H2,1-4H3/t20-,21+,27-/m1/s1 |
| InChIKey | FGZDGHZXRFEERU-PBDKAQRYSA-N |
| XLogP | 5.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|