C33H32N2O4S — CID 17241129
N-(4-ethoxyphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17241129) has the molecular formula C33H32N2O4S and a molecular weight of 552.70 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17241129 |
| Molecular Formula | C33H32N2O4S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(2-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)C2C=CCC2C(c2ccccc2OCc2ccccc2)N3)cc1 |
| InChI | InChI=1S/C33H32N2O4S/c1-2-38-25-17-15-24(16-18-25)35-40(36,37)26-19-20-31-30(21-26)27-12-8-13-28(27)33(34-31)29-11-6-7-14-32(29)39-22-23-9-4-3-5-10-23/h3-12,14-21,27-28,33-35H,2,13,22H2,1H3 |
| InChIKey | MRCGJNUGFNGCCJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|