C26H24Cl2N2O4S — CID 17239672
4-(3,5-dichloro-2-hydroxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17239672) has the molecular formula C26H24Cl2N2O4S and a molecular weight of 531.46 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-hydroxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(3,5-dichloro-2-hydroxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17239672 |
| Molecular Formula | C26H24Cl2N2O4S |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 4-(3,5-dichloro-2-hydroxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)C2C=CCC2C(c2cc(Cl)cc(Cl)c2O)N3)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O4S/c1-2-34-17-8-6-16(7-9-17)30-35(32,33)18-10-11-24-21(14-18)19-4-3-5-20(19)25(29-24)22-12-15(27)13-23(28)26(22)31/h3-4,6-14,19-20,25,29-31H,2,5H2,1H3 |
| InChIKey | XFQPIAUPPARBMM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|