C27H25BrN2O5S — CID 124538458
(3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538458) has the molecular formula C27H25BrN2O5S and a molecular weight of 569.48 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538458 |
| Molecular Formula | C27H25BrN2O5S |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | (3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2cc4c(cc2Br)OCO4)N3)cc1 |
| InChI | InChI=1S/C27H25BrN2O5S/c1-2-33-17-8-6-16(7-9-17)30-36(31,32)18-10-11-24-21(12-18)19-4-3-5-20(19)27(29-24)22-13-25-26(14-23(22)28)35-15-34-25/h3-4,6-14,19-20,27,29-30H,2,5,15H2,1H3/t19-,20+,27-/m0/s1 |
| InChIKey | LFTBSJRAKUHVEV-VKIDHGPPSA-N |
| XLogP | 6.20 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|