C30H34N2O5S — CID 124538457
(3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538457) has the molecular formula C30H34N2O5S and a molecular weight of 534.68 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538457 |
| Molecular Formula | C30H34N2O5S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc(OCC)c(OCC)c2)N3)cc1 |
| InChI | InChI=1S/C30H34N2O5S/c1-4-35-22-13-11-21(12-14-22)32-38(33,34)23-15-16-27-26(19-23)24-8-7-9-25(24)30(31-27)20-10-17-28(36-5-2)29(18-20)37-6-3/h7-8,10-19,24-25,30-32H,4-6,9H2,1-3H3/t24-,25+,30+/m0/s1 |
| InChIKey | LGJJAVFYEKUPQI-NHWZYIIXSA-N |
| XLogP | 6.51 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|