C34H34N2O5S — CID 124538503
(3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-phenoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538503) has the molecular formula C34H34N2O5S and a molecular weight of 582.72 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-phenoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-phenoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538503 |
| Molecular Formula | C34H34N2O5S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | (3aR,4S,9bS)-4-(3,4-diethoxyphenyl)-N-(4-phenoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCOc1ccc([C@H]2Nc3ccc(S(=O)(=O)Nc4ccc(Oc5ccccc5)cc4)cc3[C@H]3C=CC[C@H]32)cc1OCC |
| InChI | InChI=1S/C34H34N2O5S/c1-3-39-32-20-13-23(21-33(32)40-4-2)34-29-12-8-11-28(29)30-22-27(18-19-31(30)35-34)42(37,38)36-24-14-16-26(17-15-24)41-25-9-6-5-7-10-25/h5-11,13-22,28-29,34-36H,3-4,12H2,1-2H3/t28-,29+,34+/m0/s1 |
| InChIKey | HLHMBMJLRNAXEB-BHZGVWCHSA-N |
| XLogP | 7.90 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|