C29H30N2O4S2 — CID 126002831
(3aR,4S,9bS)-N-(2-ethoxyphenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 126002831) has the molecular formula C29H30N2O4S2 and a molecular weight of 534.70 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-(2-ethoxyphenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-N-(2-ethoxyphenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 126002831 |
| Molecular Formula | C29H30N2O4S2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (3aR,4S,9bS)-N-(2-ethoxyphenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCOc1ccccc1NS(=O)(=O)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(OC3CSC3)cc1)N2 |
| InChI | InChI=1S/C29H30N2O4S2/c1-2-34-28-9-4-3-8-27(28)31-37(32,33)22-14-15-26-25(16-22)23-6-5-7-24(23)29(30-26)19-10-12-20(13-11-19)35-21-17-36-18-21/h3-6,8-16,21,23-24,29-31H,2,7,17-18H2,1H3/t23-,24+,29+/m0/s1 |
| InChIKey | LLJTYAJRGPOYCG-CTVOUCONSA-N |
| XLogP | 6.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|