C28H28N2O3S2 — CID 126009287
(3aR,4S,9bS)-N-(4-methylphenyl)-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 126009287) has the molecular formula C28H28N2O3S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-(4-methylphenyl)-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-N-(4-methylphenyl)-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 126009287 |
| Molecular Formula | C28H28N2O3S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (3aR,4S,9bS)-N-(4-methylphenyl)-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2cccc(OC4CSC4)c2)N3)cc1 |
| InChI | InChI=1S/C28H28N2O3S2/c1-18-8-10-20(11-9-18)30-35(31,32)23-12-13-27-26(15-23)24-6-3-7-25(24)28(29-27)19-4-2-5-21(14-19)33-22-16-34-17-22/h2-6,8-15,22,24-25,28-30H,7,16-17H2,1H3/t24-,25+,28+/m0/s1 |
| InChIKey | WDKWDTRLOFDALN-BXTSTYNKSA-N |
| XLogP | 6.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|