C27H25FN2O3S2 — CID 126008058
(3aR,4S,9bS)-N-(2-fluorophenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 126008058) has the molecular formula C27H25FN2O3S2 and a molecular weight of 508.64 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-(2-fluorophenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-N-(2-fluorophenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 126008058 |
| Molecular Formula | C27H25FN2O3S2 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (3aR,4S,9bS)-N-(2-fluorophenyl)-4-[4-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1F)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(OC3CSC3)cc1)N2 |
| InChI | InChI=1S/C27H25FN2O3S2/c28-24-6-1-2-7-26(24)30-35(31,32)20-12-13-25-23(14-20)21-4-3-5-22(21)27(29-25)17-8-10-18(11-9-17)33-19-15-34-16-19/h1-4,6-14,19,21-22,27,29-30H,5,15-16H2/t21-,22+,27+/m0/s1 |
| InChIKey | VVURSCNAHLBJES-OREGWCPLSA-N |
| XLogP | 5.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|