C27H26N2O5S — CID 21234054
methyl 4-[(4S)-8-[(4-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 21234054) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is methyl 4-[(4S)-8-[(4-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(4S)-8-[(4-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 21234054 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | methyl 4-[(4S)-8-[(4-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2Nc3ccc(S(=O)(=O)Nc4ccc(OC)cc4)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c1-33-20-12-10-19(11-13-20)29-35(31,32)21-14-15-25-24(16-21)22-4-3-5-23(22)26(28-25)17-6-8-18(9-7-17)27(30)34-2/h3-4,6-16,22-23,26,28-29H,5H2,1-2H3/t22?,23?,26-/m1/s1 |
| InChIKey | CPBFYPBQPSTYSI-QGPIEZSZSA-N |
| XLogP | 5.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|