C25H21ClN2O4S — CID 6559773
4-[[(3aR,4S,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid (PubChem CID 6559773) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is 4-[[(3aR,4S,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[(3aR,4S,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6559773 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 4-[[(3aR,4S,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc(Cl)cc2)N3)cc1 |
| InChI | InChI=1S/C25H21ClN2O4S/c26-17-8-4-15(5-9-17)24-21-3-1-2-20(21)22-14-19(12-13-23(22)27-24)33(31,32)28-18-10-6-16(7-11-18)25(29)30/h1-2,4-14,20-21,24,27-28H,3H2,(H,29,30)/t20-,21+,24+/m0/s1 |
| InChIKey | MKHLHZXTUGWPHE-YZUZCNPQSA-N |
| XLogP | 5.67 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|