C24H19BrCl2N2O2S — CID 124538275
(3aR,4S,9bS)-4-(4-bromophenyl)-N-(3,5-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538275) has the molecular formula C24H19BrCl2N2O2S and a molecular weight of 550.31 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(4-bromophenyl)-N-(3,5-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(4-bromophenyl)-N-(3,5-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538275 |
| Molecular Formula | C24H19BrCl2N2O2S |
| Molecular Weight | 550.31 g/mol |
| Exact Mass | 547.97 |
| IUPAC Name | (3aR,4S,9bS)-4-(4-bromophenyl)-N-(3,5-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C24H19BrCl2N2O2S/c25-15-6-4-14(5-7-15)24-21-3-1-2-20(21)22-13-19(8-9-23(22)28-24)32(30,31)29-18-11-16(26)10-17(27)12-18/h1-2,4-13,20-21,24,28-29H,3H2/t20-,21+,24+/m0/s1 |
| InChIKey | GNNLPSQLGQDYIQ-YZUZCNPQSA-N |
| XLogP | 7.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.31 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|