C25H21FN2O4S — CID 21229938
4-[[(4S)-4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid (PubChem CID 21229938) has the molecular formula C25H21FN2O4S and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[[(4S)-4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[(4S)-4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 21229938 |
| Molecular Formula | C25H21FN2O4S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 4-[[(4S)-4-(2-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2ccc3c(c2)C2C=CCC2[C@@H](c2ccccc2F)N3)cc1 |
| InChI | InChI=1S/C25H21FN2O4S/c26-22-7-2-1-4-20(22)24-19-6-3-5-18(19)21-14-17(12-13-23(21)27-24)33(31,32)28-16-10-8-15(9-11-16)25(29)30/h1-5,7-14,18-19,24,27-28H,6H2,(H,29,30)/t18?,19?,24-/m0/s1 |
| InChIKey | CTTOGPAAVKCXEG-MORLXBONSA-N |
| XLogP | 5.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|