C26H23ClN2O4S — CID 22331733
4-[(3aR,4S,9bS)-8-[(3-chloro-4-methylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (PubChem CID 22331733) has the molecular formula C26H23ClN2O4S and a molecular weight of 495.00 g/mol. Its IUPAC name is 4-[(3aR,4S,9bS)-8-[(3-chloro-4-methylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid.
| Compound Name | 4-[(3aR,4S,9bS)-8-[(3-chloro-4-methylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 22331733 |
| Molecular Formula | C26H23ClN2O4S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 4-[(3aR,4S,9bS)-8-[(3-chloro-4-methylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc(C(=O)O)cc2)N3)cc1Cl |
| InChI | InChI=1S/C26H23ClN2O4S/c1-15-5-10-18(13-23(15)27)29-34(32,33)19-11-12-24-22(14-19)20-3-2-4-21(20)25(28-24)16-6-8-17(9-7-16)26(30)31/h2-3,5-14,20-21,25,28-29H,4H2,1H3,(H,30,31)/t20-,21+,25+/m0/s1 |
| InChIKey | QBVBLWYQYUIBEE-BPYKYCOYSA-N |
| XLogP | 5.97 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|