C26H23N2O5S- — CID 6969533
4-[(3aS,4R,9bS)-8-[(3-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 6969533) has the molecular formula C26H23N2O5S- and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-[(3aS,4R,9bS)-8-[(3-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | 4-[(3aS,4R,9bS)-8-[(3-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 6969533 |
| Molecular Formula | C26H23N2O5S- |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-[(3aS,4R,9bS)-8-[(3-methoxyphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2C=CC[C@@H]2[C@H](c2ccc(C(=O)[O-])cc2)N3)c1 |
| InChI | InChI=1S/C26H24N2O5S/c1-33-19-5-2-4-18(14-19)28-34(31,32)20-12-13-24-23(15-20)21-6-3-7-22(21)25(27-24)16-8-10-17(11-9-16)26(29)30/h2-6,8-15,21-22,25,27-28H,7H2,1H3,(H,29,30)/p-1/t21-,22-,25-/m0/s1 |
| InChIKey | SOAFFYNTNJRBTG-HWBMXIPRSA-M |
| XLogP | 3.69 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|