C25H20BrClN2O4S — CID 124538199
(3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538199) has the molecular formula C25H20BrClN2O4S and a molecular weight of 559.87 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538199 |
| Molecular Formula | C25H20BrClN2O4S |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 558.00 |
| IUPAC Name | (3aR,4S,9bS)-4-(6-bromo-1,3-benzodioxol-5-yl)-N-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1cc3c(cc1Br)OCO3)N2 |
| InChI | InChI=1S/C25H20BrClN2O4S/c26-21-12-24-23(32-13-33-24)11-20(21)25-18-6-2-5-17(18)19-10-16(7-8-22(19)28-25)34(30,31)29-15-4-1-3-14(27)9-15/h1-5,7-12,17-18,25,28-29H,6,13H2/t17-,18+,25-/m0/s1 |
| InChIKey | XNNVQOQZDDKIFX-ATLLOTDBSA-N |
| XLogP | 6.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|