C25H20ClF3N2O2S — CID 22193615
(3aS,4R,9bR)-4-(2-chlorophenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 22193615) has the molecular formula C25H20ClF3N2O2S and a molecular weight of 504.96 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(2-chlorophenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aS,4R,9bR)-4-(2-chlorophenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 22193615 |
| Molecular Formula | C25H20ClF3N2O2S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | (3aS,4R,9bR)-4-(2-chlorophenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C(F)(F)F)c1)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1Cl)N2 |
| InChI | InChI=1S/C25H20ClF3N2O2S/c26-22-10-2-1-7-20(22)24-19-9-4-8-18(19)21-14-17(11-12-23(21)30-24)34(32,33)31-16-6-3-5-15(13-16)25(27,28)29/h1-8,10-14,18-19,24,30-31H,9H2/t18-,19+,24-/m1/s1 |
| InChIKey | OLLWYMQKAZZLOQ-YDIMBITNSA-N |
| XLogP | 6.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|