C29H29F3N2O2S — CID 124538414
(3aR,4S,9bS)-4-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124538414) has the molecular formula C29H29F3N2O2S and a molecular weight of 526.62 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124538414 |
| Molecular Formula | C29H29F3N2O2S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | (3aR,4S,9bS)-4-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CC(C)(C)c1ccc([C@H]2Nc3ccc(S(=O)(=O)Nc4cccc(C(F)(F)F)c4)cc3[C@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C29H29F3N2O2S/c1-28(2,3)19-12-10-18(11-13-19)27-24-9-5-8-23(24)25-17-22(14-15-26(25)33-27)37(35,36)34-21-7-4-6-20(16-21)29(30,31)32/h4-8,10-17,23-24,27,33-34H,9H2,1-3H3/t23-,24+,27+/m0/s1 |
| InChIKey | IGSDXGHAIBNGNB-CLCZQPDDSA-N |
| XLogP | 7.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|