C22H23ClN2O2S — CID 17239503
4-(2-chlorophenyl)-8-pyrrolidin-1-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17239503) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-8-pyrrolidin-1-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2-chlorophenyl)-8-pyrrolidin-1-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17239503 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(2-chlorophenyl)-8-pyrrolidin-1-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1ccccc1Cl)N2)N1CCCC1 |
| InChI | InChI=1S/C22H23ClN2O2S/c23-20-9-2-1-6-18(20)22-17-8-5-7-16(17)19-14-15(10-11-21(19)24-22)28(26,27)25-12-3-4-13-25/h1-2,5-7,9-11,14,16-17,22,24H,3-4,8,12-13H2 |
| InChIKey | ZHECLSNYNHREBO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|