C20H22N2O2S2 — CID 17243498
8-pyrrolidin-1-ylsulfonyl-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17243498) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 8-pyrrolidin-1-ylsulfonyl-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-pyrrolidin-1-ylsulfonyl-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17243498 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 8-pyrrolidin-1-ylsulfonyl-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1cccs1)N2)N1CCCC1 |
| InChI | InChI=1S/C20H22N2O2S2/c23-26(24,22-10-1-2-11-22)14-8-9-18-17(13-14)15-5-3-6-16(15)20(21-18)19-7-4-12-25-19/h3-5,7-9,12-13,15-16,20-21H,1-2,6,10-11H2 |
| InChIKey | UFVFIIWDMLFDCW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|