C24H28N2O4S — CID 17236746
4-[8-(azepan-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzene-1,3-diol (PubChem CID 17236746) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[8-(azepan-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzene-1,3-diol.
| Compound Name | 4-[8-(azepan-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 17236746 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[8-(azepan-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzene-1,3-diol |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1ccc(O)cc1O)N2)N1CCCCCC1 |
| InChI | InChI=1S/C24H28N2O4S/c27-16-8-10-20(23(28)14-16)24-19-7-5-6-18(19)21-15-17(9-11-22(21)25-24)31(29,30)26-12-3-1-2-4-13-26/h5-6,8-11,14-15,18-19,24-25,27-28H,1-4,7,12-13H2 |
| InChIKey | JKOMCCPTKZDSGT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|