C24H26Cl2N2O2S — CID 17243013
8-(azepan-1-ylsulfonyl)-4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17243013) has the molecular formula C24H26Cl2N2O2S and a molecular weight of 477.46 g/mol. Its IUPAC name is 8-(azepan-1-ylsulfonyl)-4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(azepan-1-ylsulfonyl)-4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17243013 |
| Molecular Formula | C24H26Cl2N2O2S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 8-(azepan-1-ylsulfonyl)-4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1c(Cl)cccc1Cl)N2)N1CCCCCC1 |
| InChI | InChI=1S/C24H26Cl2N2O2S/c25-20-9-6-10-21(26)23(20)24-18-8-5-7-17(18)19-15-16(11-12-22(19)27-24)31(29,30)28-13-3-1-2-4-14-28/h5-7,9-12,15,17-18,24,27H,1-4,8,13-14H2 |
| InChIKey | CZHJOULJLKTQDQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|