C24H26ClN3O4S — CID 17240160
8-(azepan-1-ylsulfonyl)-4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17240160) has the molecular formula C24H26ClN3O4S and a molecular weight of 488.01 g/mol. Its IUPAC name is 8-(azepan-1-ylsulfonyl)-4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(azepan-1-ylsulfonyl)-4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17240160 |
| Molecular Formula | C24H26ClN3O4S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 8-(azepan-1-ylsulfonyl)-4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1cc(C2Nc3ccc(S(=O)(=O)N4CCCCCC4)cc3C3C=CCC32)ccc1Cl |
| InChI | InChI=1S/C24H26ClN3O4S/c25-21-10-8-16(14-23(21)28(29)30)24-19-7-5-6-18(19)20-15-17(9-11-22(20)26-24)33(31,32)27-12-3-1-2-4-13-27/h5-6,8-11,14-15,18-19,24,26H,1-4,7,12-13H2 |
| InChIKey | PUOJIQZUMQVIGK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|