C25H28ClN3O4S — CID 17240185
4-(4-chloro-3-nitrophenyl)-N-cyclohexyl-N-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17240185) has the molecular formula C25H28ClN3O4S and a molecular weight of 502.04 g/mol. Its IUPAC name is 4-(4-chloro-3-nitrophenyl)-N-cyclohexyl-N-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(4-chloro-3-nitrophenyl)-N-cyclohexyl-N-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17240185 |
| Molecular Formula | C25H28ClN3O4S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-(4-chloro-3-nitrophenyl)-N-cyclohexyl-N-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)c([N+](=O)[O-])c1)N2 |
| InChI | InChI=1S/C25H28ClN3O4S/c1-28(17-6-3-2-4-7-17)34(32,33)18-11-13-23-21(15-18)19-8-5-9-20(19)25(27-23)16-10-12-22(26)24(14-16)29(30)31/h5,8,10-15,17,19-20,25,27H,2-4,6-7,9H2,1H3 |
| InChIKey | WMKSNKJJTBFWMT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|