C26H32N2O2S2 — CID 17244392
N-cyclohexyl-N-methyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17244392) has the molecular formula C26H32N2O2S2 and a molecular weight of 468.69 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17244392 |
| Molecular Formula | C26H32N2O2S2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CSc1ccc(C2Nc3ccc(S(=O)(=O)N(C)C4CCCCC4)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C26H32N2O2S2/c1-28(19-7-4-3-5-8-19)32(29,30)21-15-16-25-24(17-21)22-9-6-10-23(22)26(27-25)18-11-13-20(31-2)14-12-18/h6,9,11-17,19,22-23,26-27H,3-5,7-8,10H2,1-2H3 |
| InChIKey | KJBLUYYSPNGJNE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|