C20H23N3O2S — CID 17237211
4-[4-(dimethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17237211) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17237211 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CN(C)c1ccc(C2Nc3ccc(S(N)(=O)=O)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-23(2)14-8-6-13(7-9-14)20-17-5-3-4-16(17)18-12-15(26(21,24)25)10-11-19(18)22-20/h3-4,6-12,16-17,20,22H,5H2,1-2H3,(H2,21,24,25) |
| InChIKey | ROIAXWGZIQCJFL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|